C9H10N2O2S — CID 130642913
(4S)-5-nitro-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 130642913) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is (4S)-5-nitro-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | (4S)-5-nitro-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 130642913 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | (4S)-5-nitro-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | N[C@H]1CCSc2cccc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C9H10N2O2S/c10-6-4-5-14-8-3-1-2-7(9(6)8)11(12)13/h1-3,6H,4-5,10H2/t6-/m0/s1 |
| InChIKey | MJRCNKBAJTXBGE-LURJTMIESA-N |
| XLogP | 2.09 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|