C9H8N2O4 — CID 5122445
2-cyclopropyl-1,3-dinitrobenzene (PubChem CID 5122445) has the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. Its IUPAC name is 2-cyclopropyl-1,3-dinitrobenzene.
| Compound Name | 2-cyclopropyl-1,3-dinitrobenzene |
|---|---|
| PubChem CID | 5122445 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-cyclopropyl-1,3-dinitrobenzene |
| SMILES | O=[N+]([O-])c1cccc([N+](=O)[O-])c1C1CC1 |
| InChI | InChI=1S/C9H8N2O4/c12-10(13)7-2-1-3-8(11(14)15)9(7)6-4-5-6/h1-3,6H,4-5H2 |
| InChIKey | BTNOTHNHJBVVTI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|