C12H6N4O8Se2 — CID 88784383
2-[(2,6-dinitrophenyl)diselanyl]-1,3-dinitrobenzene (PubChem CID 88784383) has the molecular formula C12H6N4O8Se2 and a molecular weight of 492.12 g/mol. Its IUPAC name is 2-[(2,6-dinitrophenyl)diselanyl]-1,3-dinitrobenzene.
| Compound Name | 2-[(2,6-dinitrophenyl)diselanyl]-1,3-dinitrobenzene |
|---|---|
| PubChem CID | 88784383 |
| Molecular Formula | C12H6N4O8Se2 |
| Molecular Weight | 492.12 g/mol |
| Exact Mass | 493.85 |
| IUPAC Name | 2-[(2,6-dinitrophenyl)diselanyl]-1,3-dinitrobenzene |
| SMILES | O=[N+]([O-])c1cccc([N+](=O)[O-])c1[Se][Se]c1c([N+](=O)[O-])cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H6N4O8Se2/c17-13(18)7-3-1-4-8(14(19)20)11(7)25-26-12-9(15(21)22)5-2-6-10(12)16(23)24/h1-6H |
| InChIKey | JUPGFGYGFRXVFO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.12 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|