C6H4N6O10 — CID 175346850
N-nitronitramide;1,2,3-trinitrobenzene (PubChem CID 175346850) has the molecular formula C6H4N6O10 and a molecular weight of 320.13 g/mol. Its IUPAC name is N-nitronitramide;1,2,3-trinitrobenzene.
| Compound Name | N-nitronitramide;1,2,3-trinitrobenzene |
|---|---|
| PubChem CID | 175346850 |
| Molecular Formula | C6H4N6O10 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | N-nitronitramide;1,2,3-trinitrobenzene |
| SMILES | O=[N+]([O-])N[N+](=O)[O-].O=[N+]([O-])c1cccc([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H3N3O6.HN3O4/c10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15;4-2(5)1-3(6)7/h1-3H;1H |
| InChIKey | FFXUQSLFSLOWPD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 227.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|