About 2,3-dinitrobenzonitrile;hydrochloride
2,3-dinitrobenzonitrile;hydrochloride (PubChem CID 19591333) has the molecular formula C7H4ClN3O4
and a molecular weight of 229.58 g/mol. Its IUPAC name is 2,3-dinitrobenzonitrile;hydrochloride.
Molecular Properties
| Compound Name | 2,3-dinitrobenzonitrile;hydrochloride |
| PubChem CID | 19591333 |
| Molecular Formula | C7H4ClN3O4 |
| Molecular Weight | 229.58 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | 2,3-dinitrobenzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cccc([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H3N3O4.ClH/c8-4-5-2-1-3-6(9(11)12)7(5)10(13)14;/h1-3H;1H |
| InChIKey | ARMKNDYYQAAFEL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 110.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.58 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dinitrobenzonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dinitrobenzonitrile;hydrochloride?
The IUPAC name of 2,3-dinitrobenzonitrile;hydrochloride (CID 19591333) is 2,3-dinitrobenzonitrile;hydrochloride.
What is the SMILES notation for 2,3-dinitrobenzonitrile;hydrochloride?
The canonical SMILES for 2,3-dinitrobenzonitrile;hydrochloride is Cl.N#Cc1cccc([N+](=O)[O-])c1[N+](=O)[O-].
What is the InChIKey of 2,3-dinitrobenzonitrile;hydrochloride?
The InChIKey is ARMKNDYYQAAFEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3N3O4.ClH/c8-4-5-2-1-3-6(9(11)12)7(5)10(13)14;/h1-3H;1H.
What are the key properties of 2,3-dinitrobenzonitrile;hydrochloride?
2,3-dinitrobenzonitrile;hydrochloride has a molecular weight of 229.58 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dinitrobenzonitrile;hydrochloride is sourced from PubChem (CID 19591333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).