C13H9N5O10 — CID 19080539
1-methyl-2,3-dinitrobenzene;1,2,3-trinitrobenzene (PubChem CID 19080539) has the molecular formula C13H9N5O10 and a molecular weight of 395.24 g/mol. Its IUPAC name is 1-methyl-2,3-dinitrobenzene;1,2,3-trinitrobenzene.
| Compound Name | 1-methyl-2,3-dinitrobenzene;1,2,3-trinitrobenzene |
|---|---|
| PubChem CID | 19080539 |
| Molecular Formula | C13H9N5O10 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 1-methyl-2,3-dinitrobenzene;1,2,3-trinitrobenzene |
| SMILES | Cc1cccc([N+](=O)[O-])c1[N+](=O)[O-].O=[N+]([O-])c1cccc([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6N2O4.C6H3N3O6/c1-5-3-2-4-6(8(10)11)7(5)9(12)13;10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15/h2-4H,1H3;1-3H |
| InChIKey | PDVDAVMGWYIMFO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 215.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|