C14H13N3O7 — CID 141452014
1-methyl-2,3-dinitrobenzene;2-(nitromethyl)phenol (PubChem CID 141452014) has the molecular formula C14H13N3O7 and a molecular weight of 335.27 g/mol. Its IUPAC name is 1-methyl-2,3-dinitrobenzene;2-(nitromethyl)phenol.
| Compound Name | 1-methyl-2,3-dinitrobenzene;2-(nitromethyl)phenol |
|---|---|
| PubChem CID | 141452014 |
| Molecular Formula | C14H13N3O7 |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 1-methyl-2,3-dinitrobenzene;2-(nitromethyl)phenol |
| SMILES | Cc1cccc([N+](=O)[O-])c1[N+](=O)[O-].O=[N+]([O-])Cc1ccccc1O |
| InChI | InChI=1S/C7H6N2O4.C7H7NO3/c1-5-3-2-4-6(8(10)11)7(5)9(12)13;9-7-4-2-1-3-6(7)5-8(10)11/h2-4H,1H3;1-4,9H,5H2 |
| InChIKey | PWCVDOCTERMBAM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|