About 2,3-dinitrophenol;1H-pyrrole
2,3-dinitrophenol;1H-pyrrole (PubChem CID 141490929) has the molecular formula C10H9N3O5
and a molecular weight of 251.20 g/mol. Its IUPAC name is 2,3-dinitrophenol;1H-pyrrole.
Molecular Properties
| Compound Name | 2,3-dinitrophenol;1H-pyrrole |
| PubChem CID | 141490929 |
| Molecular Formula | C10H9N3O5 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2,3-dinitrophenol;1H-pyrrole |
| SMILES | O=[N+]([O-])c1cccc(O)c1[N+](=O)[O-].c1cc[nH]c1 |
| InChI | InChI=1S/C6H4N2O5.C4H5N/c9-5-3-1-2-4(7(10)11)6(5)8(12)13;1-2-4-5-3-1/h1-3,9H;1-5H |
| InChIKey | PWBRRUPJTXTTEH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dinitrophenol;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dinitrophenol;1H-pyrrole?
The IUPAC name of 2,3-dinitrophenol;1H-pyrrole (CID 141490929) is 2,3-dinitrophenol;1H-pyrrole.
What is the SMILES notation for 2,3-dinitrophenol;1H-pyrrole?
The canonical SMILES for 2,3-dinitrophenol;1H-pyrrole is O=[N+]([O-])c1cccc(O)c1[N+](=O)[O-].c1cc[nH]c1.
What is the InChIKey of 2,3-dinitrophenol;1H-pyrrole?
The InChIKey is PWBRRUPJTXTTEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O5.C4H5N/c9-5-3-1-2-4(7(10)11)6(5)8(12)13;1-2-4-5-3-1/h1-3,9H;1-5H.
What are the key properties of 2,3-dinitrophenol;1H-pyrrole?
2,3-dinitrophenol;1H-pyrrole has a molecular weight of 251.20 g/mol, XLogP of 2.22, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dinitrophenol;1H-pyrrole is sourced from PubChem (CID 141490929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).