About lead(2+);2-nitrobenzene-1,3-diol
lead(2+);2-nitrobenzene-1,3-diol (PubChem CID 21125062) has the molecular formula C6H5NO4Pb+2
and a molecular weight of 362.31 g/mol. Its IUPAC name is lead(2+);2-nitrobenzene-1,3-diol.
Molecular Properties
| Compound Name | lead(2+);2-nitrobenzene-1,3-diol |
| PubChem CID | 21125062 |
| Molecular Formula | C6H5NO4Pb+2 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | lead(2+);2-nitrobenzene-1,3-diol |
| SMILES | O=[N+]([O-])c1c(O)cccc1O.[Pb+2] |
| InChI | InChI=1S/C6H5NO4.Pb/c8-4-2-1-3-5(9)6(4)7(10)11;/h1-3,8-9H;/q;+2 |
| InChIKey | XHJSXRAOLYVLSJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze lead(2+);2-nitrobenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lead(2+);2-nitrobenzene-1,3-diol?
The IUPAC name of lead(2+);2-nitrobenzene-1,3-diol (CID 21125062) is lead(2+);2-nitrobenzene-1,3-diol.
What is the SMILES notation for lead(2+);2-nitrobenzene-1,3-diol?
The canonical SMILES for lead(2+);2-nitrobenzene-1,3-diol is O=[N+]([O-])c1c(O)cccc1O.[Pb+2].
What is the InChIKey of lead(2+);2-nitrobenzene-1,3-diol?
The InChIKey is XHJSXRAOLYVLSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO4.Pb/c8-4-2-1-3-5(9)6(4)7(10)11;/h1-3,8-9H;/q;+2.
What are the key properties of lead(2+);2-nitrobenzene-1,3-diol?
lead(2+);2-nitrobenzene-1,3-diol has a molecular weight of 362.31 g/mol, XLogP of 0.63, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lead(2+);2-nitrobenzene-1,3-diol is sourced from PubChem (CID 21125062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).