About 3-(1,2-dinitro-2-phenylethenyl)-2-nitrophenol
3-(1,2-dinitro-2-phenylethenyl)-2-nitrophenol (PubChem CID 175293725) has the molecular formula C14H9N3O7
and a molecular weight of 331.24 g/mol. Its IUPAC name is 3-(1,2-dinitro-2-phenylethenyl)-2-nitrophenol.
Molecular Properties
| Compound Name | 3-(1,2-dinitro-2-phenylethenyl)-2-nitrophenol |
| PubChem CID | 175293725 |
| Molecular Formula | C14H9N3O7 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 3-(1,2-dinitro-2-phenylethenyl)-2-nitrophenol |
| SMILES | O=[N+]([O-])C(=C(c1cccc(O)c1[N+](=O)[O-])[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C14H9N3O7/c18-11-8-4-7-10(13(11)16(21)22)14(17(23)24)12(15(19)20)9-5-2-1-3-6-9/h1-8,18H |
| InChIKey | WVYMZAWSBZGLIU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2-dinitro-2-phenylethenyl)-2-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-dinitro-2-phenylethenyl)-2-nitrophenol?
The IUPAC name of 3-(1,2-dinitro-2-phenylethenyl)-2-nitrophenol (CID 175293725) is 3-(1,2-dinitro-2-phenylethenyl)-2-nitrophenol.
What is the SMILES notation for 3-(1,2-dinitro-2-phenylethenyl)-2-nitrophenol?
The canonical SMILES for 3-(1,2-dinitro-2-phenylethenyl)-2-nitrophenol is O=[N+]([O-])C(=C(c1cccc(O)c1[N+](=O)[O-])[N+](=O)[O-])c1ccccc1.
What is the InChIKey of 3-(1,2-dinitro-2-phenylethenyl)-2-nitrophenol?
The InChIKey is WVYMZAWSBZGLIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O7/c18-11-8-4-7-10(13(11)16(21)22)14(17(23)24)12(15(19)20)9-5-2-1-3-6-9/h1-8,18H.
What are the key properties of 3-(1,2-dinitro-2-phenylethenyl)-2-nitrophenol?
3-(1,2-dinitro-2-phenylethenyl)-2-nitrophenol has a molecular weight of 331.24 g/mol, XLogP of 2.68, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-dinitro-2-phenylethenyl)-2-nitrophenol is sourced from PubChem (CID 175293725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).