C12H7N5O12 — CID 88658203
2,3-dinitrophenol;2,3,4-trinitrophenol (PubChem CID 88658203) has the molecular formula C12H7N5O12 and a molecular weight of 413.21 g/mol. Its IUPAC name is 2,3-dinitrophenol;2,3,4-trinitrophenol.
| Compound Name | 2,3-dinitrophenol;2,3,4-trinitrophenol |
|---|---|
| PubChem CID | 88658203 |
| Molecular Formula | C12H7N5O12 |
| Molecular Weight | 413.21 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | 2,3-dinitrophenol;2,3,4-trinitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c([N+](=O)[O-])c1[N+](=O)[O-].O=[N+]([O-])c1cccc(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H3N3O7.C6H4N2O5/c10-4-2-1-3(7(11)12)5(8(13)14)6(4)9(15)16;9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-2,10H;1-3,9H |
| InChIKey | KXXXHVBVNBOQPI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 256.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|