C6H4FeN2O6+2 — CID 88924073
2,4-dinitrobenzene-1,3-diol;iron(2+) (PubChem CID 88924073) has the molecular formula C6H4FeN2O6+2 and a molecular weight of 255.95 g/mol. Its IUPAC name is 2,4-dinitrobenzene-1,3-diol;iron(2+).
| Compound Name | 2,4-dinitrobenzene-1,3-diol;iron(2+) |
|---|---|
| PubChem CID | 88924073 |
| Molecular Formula | C6H4FeN2O6+2 |
| Molecular Weight | 255.95 g/mol |
| Exact Mass | 255.94 |
| IUPAC Name | 2,4-dinitrobenzene-1,3-diol;iron(2+) |
| SMILES | O=[N+]([O-])c1ccc(O)c([N+](=O)[O-])c1O.[Fe+2] |
| InChI | InChI=1S/C6H4N2O6.Fe/c9-4-2-1-3(7(11)12)6(10)5(4)8(13)14;/h1-2,9-10H;/q;+2 |
| InChIKey | KLQUTRQNEFXBMW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.95 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|