C10H5FN2O6 — CID 174974436
3-fluoro-2,6-dinitronaphthalene-1,5-diol (PubChem CID 174974436) has the molecular formula C10H5FN2O6 and a molecular weight of 268.16 g/mol. Its IUPAC name is 3-fluoro-2,6-dinitronaphthalene-1,5-diol.
| Compound Name | 3-fluoro-2,6-dinitronaphthalene-1,5-diol |
|---|---|
| PubChem CID | 174974436 |
| Molecular Formula | C10H5FN2O6 |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 3-fluoro-2,6-dinitronaphthalene-1,5-diol |
| SMILES | O=[N+]([O-])c1ccc2c(O)c([N+](=O)[O-])c(F)cc2c1O |
| InChI | InChI=1S/C10H5FN2O6/c11-6-3-5-4(10(15)8(6)13(18)19)1-2-7(9(5)14)12(16)17/h1-3,14-15H |
| InChIKey | PRUGIYBALYEIKS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|