C6H4N2O7 — CID 19107665
4,5-dinitrobenzene-1,2,3-triol (PubChem CID 19107665) has the molecular formula C6H4N2O7 and a molecular weight of 216.10 g/mol. Its IUPAC name is 4,5-dinitrobenzene-1,2,3-triol.
| Compound Name | 4,5-dinitrobenzene-1,2,3-triol |
|---|---|
| PubChem CID | 19107665 |
| Molecular Formula | C6H4N2O7 |
| Molecular Weight | 216.10 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | 4,5-dinitrobenzene-1,2,3-triol |
| SMILES | O=[N+]([O-])c1cc(O)c(O)c(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H4N2O7/c9-3-1-2(7(12)13)4(8(14)15)6(11)5(3)10/h1,9-11H |
| InChIKey | XOGLOOUWYNMXGK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 146.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.10 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|