C14H8N4O14 — CID 90833544
2,2-bis(3,4-dihydroxy-2,6-dinitrophenyl)acetic acid (PubChem CID 90833544) has the molecular formula C14H8N4O14 and a molecular weight of 456.23 g/mol. Its IUPAC name is 2,2-bis(3,4-dihydroxy-2,6-dinitrophenyl)acetic acid.
| Compound Name | 2,2-bis(3,4-dihydroxy-2,6-dinitrophenyl)acetic acid |
|---|---|
| PubChem CID | 90833544 |
| Molecular Formula | C14H8N4O14 |
| Molecular Weight | 456.23 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | 2,2-bis(3,4-dihydroxy-2,6-dinitrophenyl)acetic acid |
| SMILES | O=C(O)C(c1c([N+](=O)[O-])cc(O)c(O)c1[N+](=O)[O-])c1c([N+](=O)[O-])cc(O)c(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H8N4O14/c19-5-1-3(15(25)26)7(10(12(5)21)17(29)30)9(14(23)24)8-4(16(27)28)2-6(20)13(22)11(8)18(31)32/h1-2,9,19-22H,(H,23,24) |
| InChIKey | DZBJFERFJQOCID-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 290.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|