C12H6N6O16 — CID 20534541
2,4,6-trinitrobenzene-1,3-diol (PubChem CID 20534541) has the molecular formula C12H6N6O16 and a molecular weight of 490.21 g/mol. Its IUPAC name is 2,4,6-trinitrobenzene-1,3-diol.
| Compound Name | 2,4,6-trinitrobenzene-1,3-diol |
|---|---|
| PubChem CID | 20534541 |
| Molecular Formula | C12H6N6O16 |
| Molecular Weight | 490.21 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | 2,4,6-trinitrobenzene-1,3-diol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1O.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1O |
| InChI | InChI=1S/2C6H3N3O8/c2*10-5-2(7(12)13)1-3(8(14)15)6(11)4(5)9(16)17/h2*1,10-11H |
| InChIKey | FFWARVTURFJLRE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 339.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|