C12H8N4O7 — CID 136827509
4-[(2-hydroxyphenyl)diazenyl]-2,6-dinitrobenzene-1,3-diol (PubChem CID 136827509) has the molecular formula C12H8N4O7 and a molecular weight of 320.22 g/mol. Its IUPAC name is 4-[(2-hydroxyphenyl)diazenyl]-2,6-dinitrobenzene-1,3-diol.
| Compound Name | 4-[(2-hydroxyphenyl)diazenyl]-2,6-dinitrobenzene-1,3-diol |
|---|---|
| PubChem CID | 136827509 |
| Molecular Formula | C12H8N4O7 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 4-[(2-hydroxyphenyl)diazenyl]-2,6-dinitrobenzene-1,3-diol |
| SMILES | O=[N+]([O-])c1cc(/N=N/c2ccccc2O)c(O)c([N+](=O)[O-])c1O |
| InChI | InChI=1S/C12H8N4O7/c17-9-4-2-1-3-6(9)13-14-7-5-8(15(20)21)12(19)10(11(7)18)16(22)23/h1-5,17-19H/b14-13+ |
| InChIKey | IYUVSOSUKVFTJQ-BUHFOSPRSA-N |
| XLogP | 3.04 |
| TPSA | 171.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|