C15H12N4O4S — CID 161335808
2-[(2-hydroxyphenyl)diazenyl]phenol;5-nitro-1,3-thiazole (PubChem CID 161335808) has the molecular formula C15H12N4O4S and a molecular weight of 344.35 g/mol. Its IUPAC name is 2-[(2-hydroxyphenyl)diazenyl]phenol;5-nitro-1,3-thiazole.
| Compound Name | 2-[(2-hydroxyphenyl)diazenyl]phenol;5-nitro-1,3-thiazole |
|---|---|
| PubChem CID | 161335808 |
| Molecular Formula | C15H12N4O4S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 2-[(2-hydroxyphenyl)diazenyl]phenol;5-nitro-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cncs1.Oc1ccccc1/N=N/c1ccccc1O |
| InChI | InChI=1S/C12H10N2O2.C3H2N2O2S/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16;6-5(7)3-1-4-2-8-3/h1-8,15-16H;1-2H/b14-13+; |
| InChIKey | VMADPTDOALPUET-IERUDJENSA-N |
| XLogP | 4.56 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|