About 3-[(3-hydroxy-2-methylphenyl)diazenyl]-2-methylphenol;nitrobenzene
3-[(3-hydroxy-2-methylphenyl)diazenyl]-2-methylphenol;nitrobenzene (PubChem CID 159495095) has the molecular formula C20H19N3O4
and a molecular weight of 365.39 g/mol. Its IUPAC name is 3-[(3-hydroxy-2-methylphenyl)diazenyl]-2-methylphenol;nitrobenzene.
Molecular Properties
| Compound Name | 3-[(3-hydroxy-2-methylphenyl)diazenyl]-2-methylphenol;nitrobenzene |
| PubChem CID | 159495095 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-[(3-hydroxy-2-methylphenyl)diazenyl]-2-methylphenol;nitrobenzene |
| SMILES | Cc1c(O)cccc1/N=N/c1cccc(O)c1C.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C14H14N2O2.C6H5NO2/c1-9-11(5-3-7-13(9)17)15-16-12-6-4-8-14(18)10(12)2;8-7(9)6-4-2-1-3-5-6/h3-8,17-18H,1-2H3;1-5H/b16-15+; |
| InChIKey | LYRJCAZJDRCGPD-GEEYTBSJSA-N |
| XLogP | 5.72 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-hydroxy-2-methylphenyl)diazenyl]-2-methylphenol;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-hydroxy-2-methylphenyl)diazenyl]-2-methylphenol;nitrobenzene?
The IUPAC name of 3-[(3-hydroxy-2-methylphenyl)diazenyl]-2-methylphenol;nitrobenzene (CID 159495095) is 3-[(3-hydroxy-2-methylphenyl)diazenyl]-2-methylphenol;nitrobenzene.
What is the SMILES notation for 3-[(3-hydroxy-2-methylphenyl)diazenyl]-2-methylphenol;nitrobenzene?
The canonical SMILES for 3-[(3-hydroxy-2-methylphenyl)diazenyl]-2-methylphenol;nitrobenzene is Cc1c(O)cccc1/N=N/c1cccc(O)c1C.O=[N+]([O-])c1ccccc1.
What is the InChIKey of 3-[(3-hydroxy-2-methylphenyl)diazenyl]-2-methylphenol;nitrobenzene?
The InChIKey is LYRJCAZJDRCGPD-GEEYTBSJSA-N. The full InChI is InChI=1S/C14H14N2O2.C6H5NO2/c1-9-11(5-3-7-13(9)17)15-16-12-6-4-8-14(18)10(12)2;8-7(9)6-4-2-1-3-5-6/h3-8,17-18H,1-2H3;1-5H/b16-15+;.
What are the key properties of 3-[(3-hydroxy-2-methylphenyl)diazenyl]-2-methylphenol;nitrobenzene?
3-[(3-hydroxy-2-methylphenyl)diazenyl]-2-methylphenol;nitrobenzene has a molecular weight of 365.39 g/mol, XLogP of 5.72, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-hydroxy-2-methylphenyl)diazenyl]-2-methylphenol;nitrobenzene is sourced from PubChem (CID 159495095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).