C11H8ClN5O2S3 — CID 22132864
5-(2-chloroanilino)-3H-1,3,4-thiadiazole-2-thione;5-nitro-1,3-thiazole (PubChem CID 22132864) has the molecular formula C11H8ClN5O2S3 and a molecular weight of 373.87 g/mol. Its IUPAC name is 5-(2-chloroanilino)-3H-1,3,4-thiadiazole-2-thione;5-nitro-1,3-thiazole.
| Compound Name | 5-(2-chloroanilino)-3H-1,3,4-thiadiazole-2-thione;5-nitro-1,3-thiazole |
|---|---|
| PubChem CID | 22132864 |
| Molecular Formula | C11H8ClN5O2S3 |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 372.95 |
| IUPAC Name | 5-(2-chloroanilino)-3H-1,3,4-thiadiazole-2-thione;5-nitro-1,3-thiazole |
| SMILES | O=[N+]([O-])c1cncs1.S=c1[nH]nc(Nc2ccccc2Cl)s1 |
| InChI | InChI=1S/C8H6ClN3S2.C3H2N2O2S/c9-5-3-1-2-4-6(5)10-7-11-12-8(13)14-7;6-5(7)3-1-4-2-8-3/h1-4H,(H,10,11)(H,12,13);1-2H |
| InChIKey | XIUADJVUKOIZFM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|