C10H9ClN4OS2 — CID 676689
1-(3-chloro-2-methylphenyl)-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea (PubChem CID 676689) has the molecular formula C10H9ClN4OS2 and a molecular weight of 300.80 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea |
|---|---|
| PubChem CID | 676689 |
| Molecular Formula | C10H9ClN4OS2 |
| Molecular Weight | 300.80 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea |
| SMILES | Cc1c(Cl)cccc1NC(=O)Nc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C10H9ClN4OS2/c1-5-6(11)3-2-4-7(5)12-8(16)13-9-14-15-10(17)18-9/h2-4H,1H3,(H,15,17)(H2,12,13,14,16) |
| InChIKey | KIKHERNWFPCYEI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.80 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|