C9H7N3OS2 — CID 5051635
N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)benzamide (PubChem CID 5051635) has the molecular formula C9H7N3OS2 and a molecular weight of 237.31 g/mol. Its IUPAC name is N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)benzamide.
| Compound Name | N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 5051635 |
| Molecular Formula | C9H7N3OS2 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)benzamide |
| SMILES | O=C(Nc1n[nH]c(=S)s1)c1ccccc1 |
| InChI | InChI=1S/C9H7N3OS2/c13-7(6-4-2-1-3-5-6)10-8-11-12-9(14)15-8/h1-5H,(H,12,14)(H,10,11,13) |
| InChIKey | AUMOOOLWZQSMNH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|