C10H10N4OS2 — CID 82133863
3-pyridin-3-yl-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)propanamide (PubChem CID 82133863) has the molecular formula C10H10N4OS2 and a molecular weight of 266.35 g/mol. Its IUPAC name is 3-pyridin-3-yl-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)propanamide.
| Compound Name | 3-pyridin-3-yl-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)propanamide |
|---|---|
| PubChem CID | 82133863 |
| Molecular Formula | C10H10N4OS2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 3-pyridin-3-yl-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)propanamide |
| SMILES | O=C(CCc1cccnc1)Nc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C10H10N4OS2/c15-8(12-9-13-14-10(16)17-9)4-3-7-2-1-5-11-6-7/h1-2,5-6H,3-4H2,(H,14,16)(H,12,13,15) |
| InChIKey | QDUVBFCIHUWGNA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|