C15H13N3O2S — CID 164623316
3-pyridin-3-yl-N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)propanamide (PubChem CID 164623316) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 3-pyridin-3-yl-N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)propanamide.
| Compound Name | 3-pyridin-3-yl-N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)propanamide |
|---|---|
| PubChem CID | 164623316 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 3-pyridin-3-yl-N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)propanamide |
| SMILES | O=C(CCc1cccnc1)Nc1ccc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C15H13N3O2S/c19-14(6-3-10-2-1-7-16-9-10)17-11-4-5-12-13(8-11)20-15(21)18-12/h1-2,4-5,7-9H,3,6H2,(H,17,19)(H,18,21) |
| InChIKey | PDZSDIQLFHWPIC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|