C12H11N5O2S — CID 99717199
N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)-3-(1H-1,2,4-triazol-5-yl)propanamide (PubChem CID 99717199) has the molecular formula C12H11N5O2S and a molecular weight of 289.32 g/mol. Its IUPAC name is N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)-3-(1H-1,2,4-triazol-5-yl)propanamide.
| Compound Name | N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)-3-(1H-1,2,4-triazol-5-yl)propanamide |
|---|---|
| PubChem CID | 99717199 |
| Molecular Formula | C12H11N5O2S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)-3-(1H-1,2,4-triazol-5-yl)propanamide |
| SMILES | O=C(CCc1ncn[nH]1)Nc1ccc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C12H11N5O2S/c18-11(4-3-10-13-6-14-17-10)15-7-1-2-8-9(5-7)19-12(20)16-8/h1-2,5-6H,3-4H2,(H,15,18)(H,16,20)(H,13,14,17) |
| InChIKey | MMINSOXXAYDSFW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|