C14H12N2O4S — CID 99705506
5-(methoxymethyl)-N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)furan-2-carboxamide (PubChem CID 99705506) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)furan-2-carboxamide.
| Compound Name | 5-(methoxymethyl)-N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 99705506 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 5-(methoxymethyl)-N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)furan-2-carboxamide |
| SMILES | COCc1ccc(C(=O)Nc2ccc3[nH]c(=S)oc3c2)o1 |
| InChI | InChI=1S/C14H12N2O4S/c1-18-7-9-3-5-11(19-9)13(17)15-8-2-4-10-12(6-8)20-14(21)16-10/h2-6H,7H2,1H3,(H,15,17)(H,16,21) |
| InChIKey | GVDMCZPSHLNWBQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|