C8H8N2OS — CID 59864377
6-(methylamino)-3H-1,3-benzoxazole-2-thione (PubChem CID 59864377) has the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. Its IUPAC name is 6-(methylamino)-3H-1,3-benzoxazole-2-thione.
| Compound Name | 6-(methylamino)-3H-1,3-benzoxazole-2-thione |
|---|---|
| PubChem CID | 59864377 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 6-(methylamino)-3H-1,3-benzoxazole-2-thione |
| SMILES | CNc1ccc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C8H8N2OS/c1-9-5-2-3-6-7(4-5)11-8(12)10-6/h2-4,9H,1H3,(H,10,12) |
| InChIKey | NSVSSFCTJWZLEC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 40.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|