C12H10N2O4S — CID 99717205
N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 99717205) has the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. Its IUPAC name is N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide.
| Compound Name | N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
|---|---|
| PubChem CID | 99717205 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | O=C(Nc1ccc2[nH]c(=S)oc2c1)C1=COCCO1 |
| InChI | InChI=1S/C12H10N2O4S/c15-11(10-6-16-3-4-17-10)13-7-1-2-8-9(5-7)18-12(19)14-8/h1-2,5-6H,3-4H2,(H,13,15)(H,14,19) |
| InChIKey | DYCBOGNHMHYEFE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|