C10H9FN2O3 — CID 103789893
N-(6-fluoro-3-pyridinyl)-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 103789893) has the molecular formula C10H9FN2O3 and a molecular weight of 224.19 g/mol. Its IUPAC name is N-(6-fluoro-3-pyridinyl)-2,3-dihydro-1,4-dioxine-5-carboxamide.
| Compound Name | N-(6-fluoro-3-pyridinyl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
|---|---|
| PubChem CID | 103789893 |
| Molecular Formula | C10H9FN2O3 |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | N-(6-fluoro-3-pyridinyl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)nc1)C1=COCCO1 |
| InChI | InChI=1S/C10H9FN2O3/c11-9-2-1-7(5-12-9)13-10(14)8-6-15-3-4-16-8/h1-2,5-6H,3-4H2,(H,13,14) |
| InChIKey | LLMAZEHJBGOMBV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|