C11H10FNO3 — CID 26086552
N-(3-fluorophenyl)-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 26086552) has the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2,3-dihydro-1,4-dioxine-5-carboxamide.
| Compound Name | N-(3-fluorophenyl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
|---|---|
| PubChem CID | 26086552 |
| Molecular Formula | C11H10FNO3 |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | N-(3-fluorophenyl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)C1=COCCO1 |
| InChI | InChI=1S/C11H10FNO3/c12-8-2-1-3-9(6-8)13-11(14)10-7-15-4-5-16-10/h1-3,6-7H,4-5H2,(H,13,14) |
| InChIKey | OPJLQJWNGKYVRX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |