C33H33N7O6S3 — CID 59742481
4-[bis[4-oxo-4-[(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)amino]butyl]amino]-N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)butanamide (PubChem CID 59742481) has the molecular formula C33H33N7O6S3 and a molecular weight of 719.87 g/mol. Its IUPAC name is 4-[bis[4-oxo-4-[(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)amino]butyl]amino]-N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)butanamide.
| Compound Name | 4-[bis[4-oxo-4-[(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)amino]butyl]amino]-N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)butanamide |
|---|---|
| PubChem CID | 59742481 |
| Molecular Formula | C33H33N7O6S3 |
| Molecular Weight | 719.87 g/mol |
| Exact Mass | 719.17 |
| IUPAC Name | 4-[bis[4-oxo-4-[(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)amino]butyl]amino]-N-(2-sulfanylidene-3H-1,3-benzoxazol-6-yl)butanamide |
| SMILES | O=C(CCCN(CCCC(=O)Nc1ccc2[nH]c(=S)oc2c1)CCCC(=O)Nc1ccc2[nH]c(=S)oc2c1)Nc1ccc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C33H33N7O6S3/c41-28(34-19-7-10-22-25(16-19)44-31(47)37-22)4-1-13-40(14-2-5-29(42)35-20-8-11-23-26(17-20)45-32(48)38-23)15-3-6-30(43)36-21-9-12-24-27(18-21)46-33(49)39-24/h7-12,16-18H,1-6,13-15H2,(H,34,41)(H,35,42)(H,36,43)(H,37,47)(H,38,48)(H,39,49) |
| InChIKey | WFJGQZVSIWQBIU-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 177.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.87 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|