C13H11ClFNO3 — CID 78882500
N-(4-chloro-3-fluorophenyl)-5-(methoxymethyl)furan-2-carboxamide (PubChem CID 78882500) has the molecular formula C13H11ClFNO3 and a molecular weight of 283.69 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)-5-(methoxymethyl)furan-2-carboxamide.
| Compound Name | N-(4-chloro-3-fluorophenyl)-5-(methoxymethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 78882500 |
| Molecular Formula | C13H11ClFNO3 |
| Molecular Weight | 283.69 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)-5-(methoxymethyl)furan-2-carboxamide |
| SMILES | COCc1ccc(C(=O)Nc2ccc(Cl)c(F)c2)o1 |
| InChI | InChI=1S/C13H11ClFNO3/c1-18-7-9-3-5-12(19-9)13(17)16-8-2-4-10(14)11(15)6-8/h2-6H,7H2,1H3,(H,16,17) |
| InChIKey | GJTJQISYFNWDGK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.69 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |