C14H15N5O3S2 — CID 3388977
3-nitro-4-piperidin-1-yl-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)benzamide (PubChem CID 3388977) has the molecular formula C14H15N5O3S2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 3-nitro-4-piperidin-1-yl-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)benzamide.
| Compound Name | 3-nitro-4-piperidin-1-yl-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 3388977 |
| Molecular Formula | C14H15N5O3S2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 3-nitro-4-piperidin-1-yl-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)benzamide |
| SMILES | O=C(Nc1n[nH]c(=S)s1)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H15N5O3S2/c20-12(15-13-16-17-14(23)24-13)9-4-5-10(11(8-9)19(21)22)18-6-2-1-3-7-18/h4-5,8H,1-3,6-7H2,(H,17,23)(H,15,16,20) |
| InChIKey | XLFCVEFDVAITIP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|