C16H19N5O3S — CID 7551438
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 7551438) has the molecular formula C16H19N5O3S and a molecular weight of 361.43 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 7551438 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | CCc1nnc(NC(=O)c2ccc(N3CCCCC3)c([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C16H19N5O3S/c1-2-14-18-19-16(25-14)17-15(22)11-6-7-12(13(10-11)21(23)24)20-8-4-3-5-9-20/h6-7,10H,2-5,8-9H2,1H3,(H,17,19,22) |
| InChIKey | HFLYNWUXHJOZGZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|