C18H23N5O3S — CID 26209848
3-nitro-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-4-pyrrolidin-1-ylbenzamide (PubChem CID 26209848) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is 3-nitro-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-4-pyrrolidin-1-ylbenzamide.
| Compound Name | 3-nitro-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 26209848 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 3-nitro-N-(5-pentyl-1,3,4-thiadiazol-2-yl)-4-pyrrolidin-1-ylbenzamide |
| SMILES | CCCCCc1nnc(NC(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C18H23N5O3S/c1-2-3-4-7-16-20-21-18(27-16)19-17(24)13-8-9-14(15(12-13)23(25)26)22-10-5-6-11-22/h8-9,12H,2-7,10-11H2,1H3,(H,19,21,24) |
| InChIKey | ZLTKDSQGRDQWCA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|