C15H16N4O3S — CID 4572034
3-nitro-4-piperidin-1-yl-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 4572034) has the molecular formula C15H16N4O3S and a molecular weight of 332.38 g/mol. Its IUPAC name is 3-nitro-4-piperidin-1-yl-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-nitro-4-piperidin-1-yl-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4572034 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 3-nitro-4-piperidin-1-yl-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H16N4O3S/c20-14(17-15-16-6-9-23-15)11-4-5-12(13(10-11)19(21)22)18-7-2-1-3-8-18/h4-6,9-10H,1-3,7-8H2,(H,16,17,20) |
| InChIKey | QVKUWXJLILYOHD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|