C20H24N4O3S — CID 7689779
N-[(6S)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 7689779) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[(6S)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-[(6S)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 7689779 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[(6S)-6-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | C[C@H]1CCc2nc(NC(=O)c3ccc(N4CCCCC4)c([N+](=O)[O-])c3)sc2C1 |
| InChI | InChI=1S/C20H24N4O3S/c1-13-5-7-15-18(11-13)28-20(21-15)22-19(25)14-6-8-16(17(12-14)24(26)27)23-9-3-2-4-10-23/h6,8,12-13H,2-5,7,9-11H2,1H3,(H,21,22,25)/t13-/m0/s1 |
| InChIKey | MBOGHOULGURNDA-ZDUSSCGKSA-N |
| XLogP | 4.42 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|