C10H6F3N3OS2 — CID 3307748
N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-3-(trifluoromethyl)benzamide (PubChem CID 3307748) has the molecular formula C10H6F3N3OS2 and a molecular weight of 305.31 g/mol. Its IUPAC name is N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 3307748 |
| Molecular Formula | C10H6F3N3OS2 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1n[nH]c(=S)s1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H6F3N3OS2/c11-10(12,13)6-3-1-2-5(4-6)7(17)14-8-15-16-9(18)19-8/h1-4H,(H,16,18)(H,14,15,17) |
| InChIKey | CIQVVAMPZGEKKF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|