C15H6F6N2OS — CID 89461680
N-(5,6,7-trifluoro-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)benzamide (PubChem CID 89461680) has the molecular formula C15H6F6N2OS and a molecular weight of 376.28 g/mol. Its IUPAC name is N-(5,6,7-trifluoro-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | N-(5,6,7-trifluoro-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 89461680 |
| Molecular Formula | C15H6F6N2OS |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | N-(5,6,7-trifluoro-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1nc2cc(F)c(F)c(F)c2s1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H6F6N2OS/c16-8-5-9-12(11(18)10(8)17)25-14(22-9)23-13(24)6-2-1-3-7(4-6)15(19,20)21/h1-5H,(H,22,23,24) |
| InChIKey | SFTOAORMWKGIKS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|