C14H5F5N2OS — CID 141404415
3,5-difluoro-N-(5,6,7-trifluoro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 141404415) has the molecular formula C14H5F5N2OS and a molecular weight of 344.26 g/mol. Its IUPAC name is 3,5-difluoro-N-(5,6,7-trifluoro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3,5-difluoro-N-(5,6,7-trifluoro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 141404415 |
| Molecular Formula | C14H5F5N2OS |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 3,5-difluoro-N-(5,6,7-trifluoro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nc2cc(F)c(F)c(F)c2s1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H5F5N2OS/c15-6-1-5(2-7(16)3-6)13(22)21-14-20-9-4-8(17)10(18)11(19)12(9)23-14/h1-4H,(H,20,21,22) |
| InChIKey | HEZUUWAKVMTJPX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|