C11H6ClN5O2S3 — CID 18778734
N-(2-chlorophenyl)-5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-amine (PubChem CID 18778734) has the molecular formula C11H6ClN5O2S3 and a molecular weight of 371.86 g/mol. Its IUPAC name is N-(2-chlorophenyl)-5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2-chlorophenyl)-5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 18778734 |
| Molecular Formula | C11H6ClN5O2S3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | N-(2-chlorophenyl)-5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-amine |
| SMILES | O=[N+]([O-])c1cnc(Sc2nnc(Nc3ccccc3Cl)s2)s1 |
| InChI | InChI=1S/C11H6ClN5O2S3/c12-6-3-1-2-4-7(6)14-9-15-16-11(21-9)22-10-13-5-8(20-10)17(18)19/h1-5H,(H,14,15) |
| InChIKey | UJYLVLUUOHHLNK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|