C11H7ClN4O5S2 — CID 16654164
methyl 2-[[5-(2-chloro-6-nitrophenyl)sulfanyl-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetate (PubChem CID 16654164) has the molecular formula C11H7ClN4O5S2 and a molecular weight of 374.79 g/mol. Its IUPAC name is methyl 2-[[5-(2-chloro-6-nitrophenyl)sulfanyl-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetate.
| Compound Name | methyl 2-[[5-(2-chloro-6-nitrophenyl)sulfanyl-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 16654164 |
| Molecular Formula | C11H7ClN4O5S2 |
| Molecular Weight | 374.79 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | methyl 2-[[5-(2-chloro-6-nitrophenyl)sulfanyl-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1nnc(Sc2c(Cl)cccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H7ClN4O5S2/c1-21-9(18)8(17)13-10-14-15-11(23-10)22-7-5(12)3-2-4-6(7)16(19)20/h2-4H,1H3,(H,13,14,17) |
| InChIKey | CYSMISRDMUBMMQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.79 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|