C19H18ClNO5S — CID 1281951
(3,3-dimethyl-2-oxobutyl) 2-(2-chloro-6-nitrophenyl)sulfanylbenzoate (PubChem CID 1281951) has the molecular formula C19H18ClNO5S and a molecular weight of 407.88 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2-(2-chloro-6-nitrophenyl)sulfanylbenzoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 2-(2-chloro-6-nitrophenyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 1281951 |
| Molecular Formula | C19H18ClNO5S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 2-(2-chloro-6-nitrophenyl)sulfanylbenzoate |
| SMILES | CC(C)(C)C(=O)COC(=O)c1ccccc1Sc1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18ClNO5S/c1-19(2,3)16(22)11-26-18(23)12-7-4-5-10-15(12)27-17-13(20)8-6-9-14(17)21(24)25/h4-10H,11H2,1-3H3 |
| InChIKey | YVGKZXSBDYNKIE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|