C21H23NO4S — CID 17497401
(3,3-dimethyl-2-oxobutyl) 2-(2-anilino-2-oxoethyl)sulfanylbenzoate (PubChem CID 17497401) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2-(2-anilino-2-oxoethyl)sulfanylbenzoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 2-(2-anilino-2-oxoethyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 17497401 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 2-(2-anilino-2-oxoethyl)sulfanylbenzoate |
| SMILES | CC(C)(C)C(=O)COC(=O)c1ccccc1SCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H23NO4S/c1-21(2,3)18(23)13-26-20(25)16-11-7-8-12-17(16)27-14-19(24)22-15-9-5-4-6-10-15/h4-12H,13-14H2,1-3H3,(H,22,24) |
| InChIKey | PEJGXCAYNKSWGC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |