C21H19FN2O5S — CID 18777286
[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 18777286) has the molecular formula C21H19FN2O5S and a molecular weight of 430.46 g/mol. Its IUPAC name is [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 18777286 |
| Molecular Formula | C21H19FN2O5S |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] 2-[2-(4-fluoroanilino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | O=C(CSc1ccccc1C(=O)OCC(=O)N1CCCC1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H19FN2O5S/c22-14-7-9-15(10-8-14)23-18(25)13-30-17-5-2-1-4-16(17)21(28)29-12-20(27)24-11-3-6-19(24)26/h1-2,4-5,7-10H,3,6,11-13H2,(H,23,25) |
| InChIKey | CYMKJSXKEFOARS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |