C13H14N2O2S2 — CID 173319985
2-(2-tert-butylphenyl)sulfanyl-5-nitro-1,3-thiazole (PubChem CID 173319985) has the molecular formula C13H14N2O2S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-(2-tert-butylphenyl)sulfanyl-5-nitro-1,3-thiazole.
| Compound Name | 2-(2-tert-butylphenyl)sulfanyl-5-nitro-1,3-thiazole |
|---|---|
| PubChem CID | 173319985 |
| Molecular Formula | C13H14N2O2S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-(2-tert-butylphenyl)sulfanyl-5-nitro-1,3-thiazole |
| SMILES | CC(C)(C)c1ccccc1Sc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C13H14N2O2S2/c1-13(2,3)9-6-4-5-7-10(9)18-12-14-8-11(19-12)15(16)17/h4-8H,1-3H3 |
| InChIKey | CGIUENQSOPGZOM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|