C10H8N2O3S2 — CID 102771204
[4-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]phenyl]methanol (PubChem CID 102771204) has the molecular formula C10H8N2O3S2 and a molecular weight of 268.32 g/mol. Its IUPAC name is [4-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]phenyl]methanol.
| Compound Name | [4-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]phenyl]methanol |
|---|---|
| PubChem CID | 102771204 |
| Molecular Formula | C10H8N2O3S2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | [4-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]phenyl]methanol |
| SMILES | O=[N+]([O-])c1cnc(Sc2ccc(CO)cc2)s1 |
| InChI | InChI=1S/C10H8N2O3S2/c13-6-7-1-3-8(4-2-7)16-10-11-5-9(17-10)12(14)15/h1-5,13H,6H2 |
| InChIKey | RJJZBDVYKUFAJR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|