C5H3N5O3S3 — CID 170454170
N-[5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-yl]hydroxylamine (PubChem CID 170454170) has the molecular formula C5H3N5O3S3 and a molecular weight of 277.31 g/mol. Its IUPAC name is N-[5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-yl]hydroxylamine.
| Compound Name | N-[5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 170454170 |
| Molecular Formula | C5H3N5O3S3 |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 276.94 |
| IUPAC Name | N-[5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-yl]hydroxylamine |
| SMILES | O=[N+]([O-])c1cnc(Sc2nnc(NO)s2)s1 |
| InChI | InChI=1S/C5H3N5O3S3/c11-9-3-7-8-5(15-3)16-4-6-1-2(14-4)10(12)13/h1,11H,(H,7,9) |
| InChIKey | AUHHHPULFXDZGE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|