C13H7F3N4O2S4 — CID 2746764
2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazole (PubChem CID 2746764) has the molecular formula C13H7F3N4O2S4 and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazole.
| Compound Name | 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 2746764 |
| Molecular Formula | C13H7F3N4O2S4 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 435.94 |
| IUPAC Name | 2-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,3,4-thiadiazole |
| SMILES | O=[N+]([O-])c1cnc(Sc2nnc(SCc3cccc(C(F)(F)F)c3)s2)s1 |
| InChI | InChI=1S/C13H7F3N4O2S4/c14-13(15,16)8-3-1-2-7(4-8)6-23-11-18-19-12(26-11)25-10-17-5-9(24-10)20(21)22/h1-5H,6H2 |
| InChIKey | FFQIBLAKXTYYDX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 81.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|