C14H9F3N2O4 — CID 22950728
1,3-dinitro-2-[[3-(trifluoromethyl)phenyl]methyl]benzene (PubChem CID 22950728) has the molecular formula C14H9F3N2O4 and a molecular weight of 326.23 g/mol. Its IUPAC name is 1,3-dinitro-2-[[3-(trifluoromethyl)phenyl]methyl]benzene.
| Compound Name | 1,3-dinitro-2-[[3-(trifluoromethyl)phenyl]methyl]benzene |
|---|---|
| PubChem CID | 22950728 |
| Molecular Formula | C14H9F3N2O4 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1,3-dinitro-2-[[3-(trifluoromethyl)phenyl]methyl]benzene |
| SMILES | O=[N+]([O-])c1cccc([N+](=O)[O-])c1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H9F3N2O4/c15-14(16,17)10-4-1-3-9(7-10)8-11-12(18(20)21)5-2-6-13(11)19(22)23/h1-7H,8H2 |
| InChIKey | AEXIIIYJZIJQPR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|